C35H41F3O — CID 67733167
5-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-2-ethenyloxane (PubChem CID 67733167) has the molecular formula C35H41F3O and a molecular weight of 534.71 g/mol. Its IUPAC name is 5-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-2-ethenyloxane.
| Compound Name | 5-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-2-ethenyloxane |
|---|---|
| PubChem CID | 67733167 |
| Molecular Formula | C35H41F3O |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 5-[4-[4-(4-decyl-2,3-difluorophenyl)phenyl]-3-fluorophenyl]-2-ethenyloxane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCCCCCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C35H41F3O/c1-3-5-6-7-8-9-10-11-12-27-18-22-32(35(38)34(27)37)26-15-13-25(14-16-26)31-21-19-28(23-33(31)36)29-17-20-30(4-2)39-24-29/h4,13-16,18-19,21-23,29-30H,2-3,5-12,17,20,24H2,1H3 |
| InChIKey | CLTAYNQJGAIALM-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|