C33H37F3O — CID 77344238
5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-3-fluorophenyl]-2-pent-3-enyloxane (PubChem CID 77344238) has the molecular formula C33H37F3O and a molecular weight of 506.65 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-3-fluorophenyl]-2-pent-3-enyloxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-3-fluorophenyl]-2-pent-3-enyloxane |
|---|---|
| PubChem CID | 77344238 |
| Molecular Formula | C33H37F3O |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-pentylphenyl)phenyl]-3-fluorophenyl]-2-pent-3-enyloxane |
| SMILES | CC=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C33H37F3O/c1-3-5-7-9-25-16-20-30(33(36)32(25)35)24-13-11-23(12-14-24)29-19-17-26(21-31(29)34)27-15-18-28(37-22-27)10-8-6-4-2/h4,6,11-14,16-17,19-21,27-28H,3,5,7-10,15,18,22H2,1-2H3 |
| InChIKey | BLCASAHGFVEQME-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|