C31H33F3O2 — CID 77344920
5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-3-fluorophenyl]-2-prop-1-enyl-1,3-dioxane (PubChem CID 77344920) has the molecular formula C31H33F3O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-3-fluorophenyl]-2-prop-1-enyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-3-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 77344920 |
| Molecular Formula | C31H33F3O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-hexylphenyl)phenyl]-3-fluorophenyl]-2-prop-1-enyl-1,3-dioxane |
| SMILES | CC=CC1OCC(c2ccc(-c3ccc(-c4ccc(CCCCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C31H33F3O2/c1-3-5-6-7-9-23-14-17-27(31(34)30(23)33)22-12-10-21(11-13-22)26-16-15-24(18-28(26)32)25-19-35-29(8-4-2)36-20-25/h4,8,10-18,25,29H,3,5-7,9,19-20H2,1-2H3 |
| InChIKey | ZFXRZEAMLMDDBL-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|