C32H35F3O2 — CID 67735996
5-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-3-fluorophenyl]-2-ethenyl-1,3-dioxane (PubChem CID 67735996) has the molecular formula C32H35F3O2 and a molecular weight of 508.62 g/mol. Its IUPAC name is 5-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-3-fluorophenyl]-2-ethenyl-1,3-dioxane.
| Compound Name | 5-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-3-fluorophenyl]-2-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 67735996 |
| Molecular Formula | C32H35F3O2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-[4-[4-(2,3-difluoro-4-octylphenyl)phenyl]-3-fluorophenyl]-2-ethenyl-1,3-dioxane |
| SMILES | C=CC1OCC(c2ccc(-c3ccc(-c4ccc(CCCCCCCC)c(F)c4F)cc3)c(F)c2)CO1 |
| InChI | InChI=1S/C32H35F3O2/c1-3-5-6-7-8-9-10-24-15-18-28(32(35)31(24)34)23-13-11-22(12-14-23)27-17-16-25(19-29(27)33)26-20-36-30(4-2)37-21-26/h4,11-19,26,30H,2-3,5-10,20-21H2,1H3 |
| InChIKey | DEDBJJOQCFPLBA-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|