C31H25F3O4 — CID 88964272
[4-[2,3-difluoro-4-[4-(1-hydroxybutyl)phenyl]phenyl]phenyl] 2-fluoro-4-(oxiran-2-yl)benzoate (PubChem CID 88964272) has the molecular formula C31H25F3O4 and a molecular weight of 518.53 g/mol. Its IUPAC name is [4-[2,3-difluoro-4-[4-(1-hydroxybutyl)phenyl]phenyl]phenyl] 2-fluoro-4-(oxiran-2-yl)benzoate.
| Compound Name | [4-[2,3-difluoro-4-[4-(1-hydroxybutyl)phenyl]phenyl]phenyl] 2-fluoro-4-(oxiran-2-yl)benzoate |
|---|---|
| PubChem CID | 88964272 |
| Molecular Formula | C31H25F3O4 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | [4-[2,3-difluoro-4-[4-(1-hydroxybutyl)phenyl]phenyl]phenyl] 2-fluoro-4-(oxiran-2-yl)benzoate |
| SMILES | CCCC(O)c1ccc(-c2ccc(-c3ccc(OC(=O)c4ccc(C5CO5)cc4F)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C31H25F3O4/c1-2-3-27(35)20-6-4-18(5-7-20)23-14-15-24(30(34)29(23)33)19-8-11-22(12-9-19)38-31(36)25-13-10-21(16-26(25)32)28-17-37-28/h4-16,27-28,35H,2-3,17H2,1H3 |
| InChIKey | HSIYDUMQYMAOBV-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|