C32H33F3O2 — CID 88953460
1-[4-[2,3-difluoro-4-[4-[(E)-2-[3-fluoro-4-(oxiran-2-yl)phenyl]ethenyl]cyclohexyl]phenyl]phenyl]butan-1-ol (PubChem CID 88953460) has the molecular formula C32H33F3O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-[(E)-2-[3-fluoro-4-(oxiran-2-yl)phenyl]ethenyl]cyclohexyl]phenyl]phenyl]butan-1-ol.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-[(E)-2-[3-fluoro-4-(oxiran-2-yl)phenyl]ethenyl]cyclohexyl]phenyl]phenyl]butan-1-ol |
|---|---|
| PubChem CID | 88953460 |
| Molecular Formula | C32H33F3O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-[(E)-2-[3-fluoro-4-(oxiran-2-yl)phenyl]ethenyl]cyclohexyl]phenyl]phenyl]butan-1-ol |
| SMILES | CCCC(O)c1ccc(-c2ccc(C3CCC(/C=C/c4ccc(C5CO5)c(F)c4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C32H33F3O2/c1-2-3-29(36)24-13-11-23(12-14-24)26-17-16-25(31(34)32(26)35)22-9-6-20(7-10-22)4-5-21-8-15-27(28(33)18-21)30-19-37-30/h4-5,8,11-18,20,22,29-30,36H,2-3,6-7,9-10,19H2,1H3/b5-4+ |
| InChIKey | VTMCOACJWPRHEW-SNAWJCMRSA-N |
| XLogP | 8.66 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|