C31H33F3 — CID 77470860
1-[4-[2-(4-ethyl-3-fluorophenyl)ethenyl]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene (PubChem CID 77470860) has the molecular formula C31H33F3 and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[4-[2-(4-ethyl-3-fluorophenyl)ethenyl]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-[4-[2-(4-ethyl-3-fluorophenyl)ethenyl]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 77470860 |
| Molecular Formula | C31H33F3 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 1-[4-[2-(4-ethyl-3-fluorophenyl)ethenyl]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(C=Cc4ccc(CC)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H33F3/c1-3-5-21-8-14-25(15-9-21)27-18-19-28(31(34)30(27)33)26-16-10-22(11-17-26)6-7-23-12-13-24(4-2)29(32)20-23/h6-7,10-13,16-21,25H,3-5,8-9,14-15H2,1-2H3 |
| InChIKey | LILKOFFETAKAFY-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|