C30H31F3 — CID 77470859
2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethenyl]phenyl]-4-(4-propylcyclohexyl)benzene (PubChem CID 77470859) has the molecular formula C30H31F3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethenyl]phenyl]-4-(4-propylcyclohexyl)benzene.
| Compound Name | 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethenyl]phenyl]-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 77470859 |
| Molecular Formula | C30H31F3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 2,3-difluoro-1-[4-[2-(3-fluoro-4-methylphenyl)ethenyl]phenyl]-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(C=Cc4ccc(C)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H31F3/c1-3-4-21-9-13-24(14-10-21)26-17-18-27(30(33)29(26)32)25-15-11-22(12-16-25)7-8-23-6-5-20(2)28(31)19-23/h5-8,11-12,15-19,21,24H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | SQXPWKCZJYCBBU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|