C21H21F5 — CID 118593448
2,3-difluoro-1-(4-propylcyclohexyl)-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118593448) has the molecular formula C21H21F5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2,3-difluoro-1-(4-propylcyclohexyl)-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 2,3-difluoro-1-(4-propylcyclohexyl)-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118593448 |
| Molecular Formula | C21H21F5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2,3-difluoro-1-(4-propylcyclohexyl)-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H21F5/c1-2-3-12-4-6-13(7-5-12)15-8-9-16(20(25)19(15)24)14-10-17(22)21(26)18(23)11-14/h8-13H,2-7H2,1H3 |
| InChIKey | NANJVZSLZIZARZ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|