C29H27F7O2 — CID 118858944
1-[4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene (PubChem CID 118858944) has the molecular formula C29H27F7O2 and a molecular weight of 540.52 g/mol. Its IUPAC name is 1-[4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene.
| Compound Name | 1-[4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 118858944 |
| Molecular Formula | C29H27F7O2 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[4-[2,2-difluoro-2-(3,4,5-trifluorophenoxy)ethoxy]phenyl]-2,3-difluoro-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(-c3ccc(OCC(F)(F)Oc4cc(F)c(F)c(F)c4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H27F7O2/c1-2-3-17-4-6-18(7-5-17)22-12-13-23(27(33)26(22)32)19-8-10-20(11-9-19)37-16-29(35,36)38-21-14-24(30)28(34)25(31)15-21/h8-15,17-18H,2-7,16H2,1H3 |
| InChIKey | AQRTYGITMZIJDX-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|