C30H30F4 — CID 67730829
1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene (PubChem CID 67730829) has the molecular formula C30H30F4 and a molecular weight of 466.56 g/mol. Its IUPAC name is 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene.
| Compound Name | 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 67730829 |
| Molecular Formula | C30H30F4 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 1-[4-(2,3-difluoro-4-methylphenyl)phenyl]-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(-c4ccc(C)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H30F4/c1-3-4-5-6-20-8-10-21(11-9-20)25-17-18-26(30(34)29(25)33)23-14-12-22(13-15-23)24-16-7-19(2)27(31)28(24)32/h3-4,7,12-18,20-21H,5-6,8-11H2,1-2H3/b4-3+ |
| InChIKey | PBWCNUGHZSXUJG-ONEGZZNKSA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|