C29H27F3O2 — CID 88963912
2-[4-[[4-[4-(4-ethenylphenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2-fluorophenyl]oxirane (PubChem CID 88963912) has the molecular formula C29H27F3O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is 2-[4-[[4-[4-(4-ethenylphenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2-fluorophenyl]oxirane.
| Compound Name | 2-[4-[[4-[4-(4-ethenylphenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2-fluorophenyl]oxirane |
|---|---|
| PubChem CID | 88963912 |
| Molecular Formula | C29H27F3O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[4-[[4-[4-(4-ethenylphenyl)-2,3-difluorophenyl]cyclohexyl]methoxy]-2-fluorophenyl]oxirane |
| SMILES | C=Cc1ccc(-c2ccc(C3CCC(COc4ccc(C5CO5)c(F)c4)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C29H27F3O2/c1-2-18-3-7-20(8-4-18)23-13-14-24(29(32)28(23)31)21-9-5-19(6-10-21)16-33-22-11-12-25(26(30)15-22)27-17-34-27/h2-4,7-8,11-15,19,21,27H,1,5-6,9-10,16-17H2 |
| InChIKey | VDEDVBKTILITKN-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|