C29H31F3O2 — CID 88953669
2-[4-[[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]phenoxy]methyl]-2-fluorocyclohex-2-en-1-yl]oxirane (PubChem CID 88953669) has the molecular formula C29H31F3O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[4-[[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]phenoxy]methyl]-2-fluorocyclohex-2-en-1-yl]oxirane.
| Compound Name | 2-[4-[[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]phenoxy]methyl]-2-fluorocyclohex-2-en-1-yl]oxirane |
|---|---|
| PubChem CID | 88953669 |
| Molecular Formula | C29H31F3O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 2-[4-[[4-[4-(4-ethenylcyclohexyl)-2,3-difluorophenyl]phenoxy]methyl]-2-fluorocyclohex-2-en-1-yl]oxirane |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCC4C=C(F)C(C5CO5)CC4)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H31F3O2/c1-2-18-3-6-20(7-4-18)23-13-14-24(29(32)28(23)31)21-8-10-22(11-9-21)33-16-19-5-12-25(26(30)15-19)27-17-34-27/h2,8-11,13-15,18-20,25,27H,1,3-7,12,16-17H2 |
| InChIKey | MPUIFOBPANEYIC-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|