C29H31F3O2 — CID 143909126
1-(4-ethenylcyclohexyl)-4-[4-[(3E)-5-ethoxy-3-fluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluorobenzene (PubChem CID 143909126) has the molecular formula C29H31F3O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-4-[4-[(3E)-5-ethoxy-3-fluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-4-[4-[(3E)-5-ethoxy-3-fluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143909126 |
| Molecular Formula | C29H31F3O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-4-[4-[(3E)-5-ethoxy-3-fluoro-2-methylidenehexa-3,5-dienoxy]phenyl]-2,3-difluorobenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(OCC(=C)/C(F)=C\C(=C)OCC)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H31F3O2/c1-5-21-7-9-22(10-8-21)25-15-16-26(29(32)28(25)31)23-11-13-24(14-12-23)34-18-19(3)27(30)17-20(4)33-6-2/h5,11-17,21-22H,1,3-4,6-10,18H2,2H3/b27-17+ |
| InChIKey | NJNYDVMTICUECU-WPWMEQJKSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|