C30H33F3O — CID 143909097
1-(4-ethenylcyclohexyl)-4-[4-[(4E)-6-ethoxy-4-fluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorobenzene (PubChem CID 143909097) has the molecular formula C30H33F3O and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-(4-ethenylcyclohexyl)-4-[4-[(4E)-6-ethoxy-4-fluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorobenzene.
| Compound Name | 1-(4-ethenylcyclohexyl)-4-[4-[(4E)-6-ethoxy-4-fluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 143909097 |
| Molecular Formula | C30H33F3O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-(4-ethenylcyclohexyl)-4-[4-[(4E)-6-ethoxy-4-fluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluorobenzene |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(CCC(=C)/C(F)=C\C(=C)OCC)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C30H33F3O/c1-5-22-9-13-24(14-10-22)26-17-18-27(30(33)29(26)32)25-15-11-23(12-16-25)8-7-20(3)28(31)19-21(4)34-6-2/h5,11-12,15-19,22,24H,1,3-4,6-10,13-14H2,2H3/b28-19+ |
| InChIKey | BGABGGALTJSZBL-TURZUDJPSA-N |
| XLogP | 8.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|