C28H30F4O2 — CID 143909645
4-[4-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]cyclohexyl]-2,3-difluorophenyl]phenol (PubChem CID 143909645) has the molecular formula C28H30F4O2 and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-[4-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]cyclohexyl]-2,3-difluorophenyl]phenol.
| Compound Name | 4-[4-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]cyclohexyl]-2,3-difluorophenyl]phenol |
|---|---|
| PubChem CID | 143909645 |
| Molecular Formula | C28H30F4O2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 4-[4-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]cyclohexyl]-2,3-difluorophenyl]phenol |
| SMILES | C=C(CCC1CCC(c2ccc(-c3ccc(O)cc3)c(F)c2F)CC1)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C28H30F4O2/c1-4-34-18(3)26(30)25(29)17(2)5-6-19-7-9-20(10-8-19)23-15-16-24(28(32)27(23)31)21-11-13-22(33)14-12-21/h11-16,19-20,33H,2-10H2,1H3/b26-25- |
| InChIKey | SPBDTPXSFNQVHT-QPLCGJKRSA-N |
| XLogP | 8.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|