C29H26F4O2 — CID 143909216
1-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene (PubChem CID 143909216) has the molecular formula C29H26F4O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is 1-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene.
| Compound Name | 1-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 143909216 |
| Molecular Formula | C29H26F4O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[4-[(4Z)-6-ethoxy-4,5-difluoro-3-methylidenehepta-4,6-dienyl]phenyl]-2,3-difluoro-4-(4-methoxyphenyl)benzene |
| SMILES | C=C(CCc1ccc(-c2ccc(-c3ccc(OC)cc3)c(F)c2F)cc1)/C(F)=C(/F)C(=C)OCC |
| InChI | InChI=1S/C29H26F4O2/c1-5-35-19(3)27(31)26(30)18(2)6-7-20-8-10-21(11-9-20)24-16-17-25(29(33)28(24)32)22-12-14-23(34-4)15-13-22/h8-17H,2-3,5-7H2,1,4H3/b27-26- |
| InChIKey | PHPKVKHVOMTLQE-RQZHXJHFSA-N |
| XLogP | 8.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|