C28H25F3O2 — CID 143909649
2,3-difluoro-1-[4-[(4E)-5-fluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-4-(4-methoxyphenyl)benzene (PubChem CID 143909649) has the molecular formula C28H25F3O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[(4E)-5-fluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-4-(4-methoxyphenyl)benzene.
| Compound Name | 2,3-difluoro-1-[4-[(4E)-5-fluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-4-(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 143909649 |
| Molecular Formula | C28H25F3O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2,3-difluoro-1-[4-[(4E)-5-fluoro-6-methoxy-3-methylidenehepta-4,6-dienyl]phenyl]-4-(4-methoxyphenyl)benzene |
| SMILES | C=C(/C=C(/F)C(=C)OC)CCc1ccc(-c2ccc(-c3ccc(OC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H25F3O2/c1-18(17-26(29)19(2)32-3)5-6-20-7-9-21(10-8-20)24-15-16-25(28(31)27(24)30)22-11-13-23(33-4)14-12-22/h7-17H,1-2,5-6H2,3-4H3/b26-17+ |
| InChIKey | DBCHXKGYHCZKCY-YZSQISJMSA-N |
| XLogP | 7.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|