C25H28F2O — CID 145339846
1-[4-[(Z)-3,6-dimethylideneoct-4-enyl]phenyl]-2,3-difluoro-4-propoxybenzene (PubChem CID 145339846) has the molecular formula C25H28F2O and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-[4-[(Z)-3,6-dimethylideneoct-4-enyl]phenyl]-2,3-difluoro-4-propoxybenzene.
| Compound Name | 1-[4-[(Z)-3,6-dimethylideneoct-4-enyl]phenyl]-2,3-difluoro-4-propoxybenzene |
|---|---|
| PubChem CID | 145339846 |
| Molecular Formula | C25H28F2O |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[4-[(Z)-3,6-dimethylideneoct-4-enyl]phenyl]-2,3-difluoro-4-propoxybenzene |
| SMILES | C=C(/C=C\C(=C)CCc1ccc(-c2ccc(OCCC)c(F)c2F)cc1)CC |
| InChI | InChI=1S/C25H28F2O/c1-5-17-28-23-16-15-22(24(26)25(23)27)21-13-11-20(12-14-21)10-9-19(4)8-7-18(3)6-2/h7-8,11-16H,3-6,9-10,17H2,1-2H3/b8-7- |
| InChIKey | WJNNPKROURNHHG-FPLPWBNLSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|