C26H30F2O — CID 138534906
1-ethoxy-2,3-difluoro-4-[(2E,4Z)-6-methylidene-8-(4-propylphenyl)octa-2,4-dien-3-yl]benzene (PubChem CID 138534906) has the molecular formula C26H30F2O and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[(2E,4Z)-6-methylidene-8-(4-propylphenyl)octa-2,4-dien-3-yl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[(2E,4Z)-6-methylidene-8-(4-propylphenyl)octa-2,4-dien-3-yl]benzene |
|---|---|
| PubChem CID | 138534906 |
| Molecular Formula | C26H30F2O |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[(2E,4Z)-6-methylidene-8-(4-propylphenyl)octa-2,4-dien-3-yl]benzene |
| SMILES | C=C(/C=C\C(=C/C)c1ccc(OCC)c(F)c1F)CCc1ccc(CCC)cc1 |
| InChI | InChI=1S/C26H30F2O/c1-5-8-20-12-14-21(15-13-20)11-9-19(4)10-16-22(6-2)23-17-18-24(29-7-3)26(28)25(23)27/h6,10,12-18H,4-5,7-9,11H2,1-3H3/b16-10-,22-6+ |
| InChIKey | IZXYNSUFJFCXFM-XTNKHABBSA-N |
| XLogP | 7.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|