C16H21N — CID 145059876
4-[(Z)-3,6-dimethylideneoct-4-enyl]aniline (PubChem CID 145059876) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[(Z)-3,6-dimethylideneoct-4-enyl]aniline.
| Compound Name | 4-[(Z)-3,6-dimethylideneoct-4-enyl]aniline |
|---|---|
| PubChem CID | 145059876 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4-[(Z)-3,6-dimethylideneoct-4-enyl]aniline |
| SMILES | C=C(/C=C\C(=C)CCc1ccc(N)cc1)CC |
| InChI | InChI=1S/C16H21N/c1-4-13(2)5-6-14(3)7-8-15-9-11-16(17)12-10-15/h5-6,9-12H,2-4,7-8,17H2,1H3/b6-5- |
| InChIKey | IXGKITJBODHBRJ-WAYWQWQTSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|