C15H23NO — CID 116605500
1-(4-aminophenyl)nonan-3-one (PubChem CID 116605500) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-(4-aminophenyl)nonan-3-one.
| Compound Name | 1-(4-aminophenyl)nonan-3-one |
|---|---|
| PubChem CID | 116605500 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-(4-aminophenyl)nonan-3-one |
| SMILES | CCCCCCC(=O)CCc1ccc(N)cc1 |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-5-6-15(17)12-9-13-7-10-14(16)11-8-13/h7-8,10-11H,2-6,9,12,16H2,1H3 |
| InChIKey | NORQUCJRIVBPOP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|