C15H21N3 — CID 144833951
(3Z)-1-N-[2-(4-aminophenyl)ethyl]-2-methylidenehexa-3,5-diene-1,5-diamine (PubChem CID 144833951) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (3Z)-1-N-[2-(4-aminophenyl)ethyl]-2-methylidenehexa-3,5-diene-1,5-diamine.
| Compound Name | (3Z)-1-N-[2-(4-aminophenyl)ethyl]-2-methylidenehexa-3,5-diene-1,5-diamine |
|---|---|
| PubChem CID | 144833951 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (3Z)-1-N-[2-(4-aminophenyl)ethyl]-2-methylidenehexa-3,5-diene-1,5-diamine |
| SMILES | C=C(N)/C=C\C(=C)CNCCc1ccc(N)cc1 |
| InChI | InChI=1S/C15H21N3/c1-12(3-4-13(2)16)11-18-10-9-14-5-7-15(17)8-6-14/h3-8,18H,1-2,9-11,16-17H2/b4-3- |
| InChIKey | ZKTBCNBDLBWMLK-ARJAWSKDSA-N |
| XLogP | 1.99 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|