C17H24N2O — CID 144690321
(2R,3E,5Z,7Z)-1-[2-(4-aminophenyl)ethylamino]nona-3,5,7-trien-2-ol (PubChem CID 144690321) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (2R,3E,5Z,7Z)-1-[2-(4-aminophenyl)ethylamino]nona-3,5,7-trien-2-ol.
| Compound Name | (2R,3E,5Z,7Z)-1-[2-(4-aminophenyl)ethylamino]nona-3,5,7-trien-2-ol |
|---|---|
| PubChem CID | 144690321 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2R,3E,5Z,7Z)-1-[2-(4-aminophenyl)ethylamino]nona-3,5,7-trien-2-ol |
| SMILES | C/C=C\C=C/C=C/[C@@H](O)CNCCc1ccc(N)cc1 |
| InChI | InChI=1S/C17H24N2O/c1-2-3-4-5-6-7-17(20)14-19-13-12-15-8-10-16(18)11-9-15/h2-11,17,19-20H,12-14,18H2,1H3/b3-2-,5-4-,7-6+/t17-/m1/s1 |
| InChIKey | GKLSQXZJDHXIGW-PZNTUQMGSA-N |
| XLogP | 2.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|