About CID 23389090
CID 23389090 (PubChem CID 23389090) has the molecular formula C9H11BN2O
and a molecular weight of 174.01 g/mol.
Molecular Properties
| Compound Name | CID 23389090 |
| PubChem CID | 23389090 |
| Molecular Formula | C9H11BN2O |
| Molecular Weight | 174.01 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCCc1ccc(N)cc1 |
| InChI | InChI=1S/C9H11BN2O/c10-9(13)12-6-5-7-1-3-8(11)4-2-7/h1-4H,5-6,11H2,(H,12,13) |
| InChIKey | YPHRHSQIKAGHCO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.01 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23389090 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23389090?
The IUPAC name of CID 23389090 (CID 23389090) is not available.
What is the SMILES notation for CID 23389090?
The canonical SMILES for CID 23389090 is [B]C(=O)NCCc1ccc(N)cc1.
What is the InChIKey of CID 23389090?
The InChIKey is YPHRHSQIKAGHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BN2O/c10-9(13)12-6-5-7-1-3-8(11)4-2-7/h1-4H,5-6,11H2,(H,12,13).
What are the key properties of CID 23389090?
CID 23389090 has a molecular weight of 174.01 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23389090 is sourced from PubChem (CID 23389090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).