C11H14ClF3N2O — CID 119548642
N-[2-(4-aminophenyl)ethyl]-3,3,3-trifluoropropanamide;hydrochloride (PubChem CID 119548642) has the molecular formula C11H14ClF3N2O and a molecular weight of 282.69 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3,3,3-trifluoropropanamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3,3,3-trifluoropropanamide;hydrochloride |
|---|---|
| PubChem CID | 119548642 |
| Molecular Formula | C11H14ClF3N2O |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3,3,3-trifluoropropanamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CCNC(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O.ClH/c12-11(13,14)7-10(17)16-6-5-8-1-3-9(15)4-2-8;/h1-4H,5-7,15H2,(H,16,17);1H |
| InChIKey | DGRIZAOVPDYOAR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|