C12H15F3N2O — CID 63228293
3-(4-aminophenyl)-N-(3,3,3-trifluoropropyl)propanamide (PubChem CID 63228293) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(3,3,3-trifluoropropyl)propanamide.
| Compound Name | 3-(4-aminophenyl)-N-(3,3,3-trifluoropropyl)propanamide |
|---|---|
| PubChem CID | 63228293 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-(4-aminophenyl)-N-(3,3,3-trifluoropropyl)propanamide |
| SMILES | Nc1ccc(CCC(=O)NCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)7-8-17-11(18)6-3-9-1-4-10(16)5-2-9/h1-2,4-5H,3,6-8,16H2,(H,17,18) |
| InChIKey | AVEGWNMRFKJPKU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|