C12H15F3N2O3S — CID 60906071
3,3,3-trifluoro-N-[3-(4-sulfamoylphenyl)propyl]propanamide (PubChem CID 60906071) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-(4-sulfamoylphenyl)propyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[3-(4-sulfamoylphenyl)propyl]propanamide |
|---|---|
| PubChem CID | 60906071 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-(4-sulfamoylphenyl)propyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCCNC(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)8-11(18)17-7-1-2-9-3-5-10(6-4-9)21(16,19)20/h3-6H,1-2,7-8H2,(H,17,18)(H2,16,19,20) |
| InChIKey | OOVUMVGFIQBUBT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|