C17H24N2O — CID 144690325
4-[2-(2-cyclohexa-1,5-dien-1-ylethylamino)ethyl]aniline;formaldehyde (PubChem CID 144690325) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 4-[2-(2-cyclohexa-1,5-dien-1-ylethylamino)ethyl]aniline;formaldehyde.
| Compound Name | 4-[2-(2-cyclohexa-1,5-dien-1-ylethylamino)ethyl]aniline;formaldehyde |
|---|---|
| PubChem CID | 144690325 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4-[2-(2-cyclohexa-1,5-dien-1-ylethylamino)ethyl]aniline;formaldehyde |
| SMILES | C=O.Nc1ccc(CCNCCC2=CCCC=C2)cc1 |
| InChI | InChI=1S/C16H22N2.CH2O/c17-16-8-6-15(7-9-16)11-13-18-12-10-14-4-2-1-3-5-14;1-2/h2,4-9,18H,1,3,10-13,17H2;1H2 |
| InChIKey | ZEBNXVJSKUSWRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|