About 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine
4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine (PubChem CID 143761015) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine |
| PubChem CID | 143761015 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine |
| SMILES | C=C(C)NCCCCC1=CCCC=C1 |
| InChI | InChI=1S/C13H21N/c1-12(2)14-11-7-6-10-13-8-4-3-5-9-13/h4,8-9,14H,1,3,5-7,10-11H2,2H3 |
| InChIKey | BNCNOXYMPFFWNP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine (CID 143761015) is 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine is C=C(C)NCCCCC1=CCCC=C1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine?
The InChIKey is BNCNOXYMPFFWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-12(2)14-11-7-6-10-13-8-4-3-5-9-13/h4,8-9,14H,1,3,5-7,10-11H2,2H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine?
4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine has a molecular weight of 191.32 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine is sourced from PubChem (CID 143761015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).