C13H21N — CID 143761015
4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine (PubChem CID 143761015) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 143761015 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-prop-1-en-2-ylbutan-1-amine |
| SMILES | C=C(C)NCCCCC1=CCCC=C1 |
| InChI | InChI=1S/C13H21N/c1-12(2)14-11-7-6-10-13-8-4-3-5-9-13/h4,8-9,14H,1,3,5-7,10-11H2,2H3 |
| InChIKey | BNCNOXYMPFFWNP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|