C11H17NO — CID 142459410
N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-methylacetamide (PubChem CID 142459410) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-methylacetamide.
| Compound Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 142459410 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)-N-methylacetamide |
| SMILES | CC(=O)N(C)CCC1=CCCC=C1 |
| InChI | InChI=1S/C11H17NO/c1-10(13)12(2)9-8-11-6-4-3-5-7-11/h4,6-7H,3,5,8-9H2,1-2H3 |
| InChIKey | DSUOQLRULNXPBF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |