C19H26O2 — CID 145349001
[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl] 5-cyclohexa-1,5-dien-1-ylpentanoate (PubChem CID 145349001) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is [(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl] 5-cyclohexa-1,5-dien-1-ylpentanoate.
| Compound Name | [(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl] 5-cyclohexa-1,5-dien-1-ylpentanoate |
|---|---|
| PubChem CID | 145349001 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl] 5-cyclohexa-1,5-dien-1-ylpentanoate |
| SMILES | C=C(C)/C=C\C(=C/C)OC(=O)CCCCC1=CCCC=C1 |
| InChI | InChI=1S/C19H26O2/c1-4-18(15-14-16(2)3)21-19(20)13-9-8-12-17-10-6-5-7-11-17/h4,6,10-11,14-15H,2,5,7-9,12-13H2,1,3H3/b15-14-,18-4+ |
| InChIKey | UBXKDXRZQHQLHJ-DHQSKIAISA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|