C28H49N — CID 145281348
acetonitrile;(6Z)-9-ethyl-10-methyldodeca-1,6-diene;2-pentylcyclohexa-1,3-diene (PubChem CID 145281348) has the molecular formula C28H49N and a molecular weight of 399.71 g/mol. Its IUPAC name is acetonitrile;(6Z)-9-ethyl-10-methyldodeca-1,6-diene;2-pentylcyclohexa-1,3-diene.
| Compound Name | acetonitrile;(6Z)-9-ethyl-10-methyldodeca-1,6-diene;2-pentylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145281348 |
| Molecular Formula | C28H49N |
| Molecular Weight | 399.71 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | acetonitrile;(6Z)-9-ethyl-10-methyldodeca-1,6-diene;2-pentylcyclohexa-1,3-diene |
| SMILES | C=CCCC/C=C\CC(CC)C(C)CC.CC#N.CCCCCC1=CCCC=C1 |
| InChI | InChI=1S/C15H28.C11H18.C2H3N/c1-5-8-9-10-11-12-13-15(7-3)14(4)6-2;1-2-3-5-8-11-9-6-4-7-10-11;1-2-3/h5,11-12,14-15H,1,6-10,13H2,2-4H3;6,9-10H,2-5,7-8H2,1H3;1H3/b12-11-;; |
| InChIKey | GSNIHSUXQMFIII-IPEZHVIRSA-N |
| XLogP | 9.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.71 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|