C12H19NO — CID 144778052
1-(cyclohexa-1,5-dien-1-ylmethylamino)pentan-3-one (PubChem CID 144778052) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethylamino)pentan-3-one.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethylamino)pentan-3-one |
|---|---|
| PubChem CID | 144778052 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethylamino)pentan-3-one |
| SMILES | CCC(=O)CCNCC1=CCCC=C1 |
| InChI | InChI=1S/C12H19NO/c1-2-12(14)8-9-13-10-11-6-4-3-5-7-11/h4,6-7,13H,2-3,5,8-10H2,1H3 |
| InChIKey | UUGKBJASJWULSA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|