C9H14N2O2 — CID 55252563
(2S)-2-amino-3-cyclohexa-1,5-dien-1-yl-N-hydroxypropanamide (PubChem CID 55252563) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2S)-2-amino-3-cyclohexa-1,5-dien-1-yl-N-hydroxypropanamide.
| Compound Name | (2S)-2-amino-3-cyclohexa-1,5-dien-1-yl-N-hydroxypropanamide |
|---|---|
| PubChem CID | 55252563 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2S)-2-amino-3-cyclohexa-1,5-dien-1-yl-N-hydroxypropanamide |
| SMILES | N[C@@H](CC1=CCCC=C1)C(=O)NO |
| InChI | InChI=1S/C9H14N2O2/c10-8(9(12)11-13)6-7-4-2-1-3-5-7/h2,4-5,8,13H,1,3,6,10H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | ZPEWQXOGIVVFTJ-QMMMGPOBSA-N |
| XLogP | 0.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|