C10H17NO2 — CID 144958842
2-amino-3-cyclohexa-1,5-dien-1-ylpropanal;methanol (PubChem CID 144958842) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 2-amino-3-cyclohexa-1,5-dien-1-ylpropanal;methanol.
| Compound Name | 2-amino-3-cyclohexa-1,5-dien-1-ylpropanal;methanol |
|---|---|
| PubChem CID | 144958842 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 2-amino-3-cyclohexa-1,5-dien-1-ylpropanal;methanol |
| SMILES | CO.NC(C=O)CC1=CCCC=C1 |
| InChI | InChI=1S/C9H13NO.CH4O/c10-9(7-11)6-8-4-2-1-3-5-8;1-2/h2,4-5,7,9H,1,3,6,10H2;2H,1H3 |
| InChIKey | RCOFPGQHMCQCJU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|