C10H14O — CID 144910636
(2S)-3-cyclohexa-1,5-dien-1-yl-2-methylpropanal (PubChem CID 144910636) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (2S)-3-cyclohexa-1,5-dien-1-yl-2-methylpropanal.
| Compound Name | (2S)-3-cyclohexa-1,5-dien-1-yl-2-methylpropanal |
|---|---|
| PubChem CID | 144910636 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2S)-3-cyclohexa-1,5-dien-1-yl-2-methylpropanal |
| SMILES | C[C@H](C=O)CC1=CCCC=C1 |
| InChI | InChI=1S/C10H14O/c1-9(8-11)7-10-5-3-2-4-6-10/h3,5-6,8-9H,2,4,7H2,1H3/t9-/m0/s1 |
| InChIKey | NDRZVNOMXHRRBJ-VIFPVBQESA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|