C13H20FmNO3- — CID 168915524
(5-cyclohexa-1,5-dien-1-ylpentan-2-ylamino)methanone;fermium;formic acid (PubChem CID 168915524) has the molecular formula C13H20FmNO3- and a molecular weight of 495.31 g/mol. Its IUPAC name is (5-cyclohexa-1,5-dien-1-ylpentan-2-ylamino)methanone;fermium;formic acid.
| Compound Name | (5-cyclohexa-1,5-dien-1-ylpentan-2-ylamino)methanone;fermium;formic acid |
|---|---|
| PubChem CID | 168915524 |
| Molecular Formula | C13H20FmNO3- |
| Molecular Weight | 495.31 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (5-cyclohexa-1,5-dien-1-ylpentan-2-ylamino)methanone;fermium;formic acid |
| SMILES | CC(CCCC1=CCCC=C1)N[C-]=O.O=CO.[Fm] |
| InChI | InChI=1S/C12H18NO.CH2O2.Fm/c1-11(13-10-14)6-5-9-12-7-3-2-4-8-12;2-1-3;/h3,7-8,11H,2,4-6,9H2,1H3,(H,13,14);1H,(H,2,3);/q-1;; |
| InChIKey | NBZATNCMMBMQFB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|