C12H23N — CID 144703762
N-(cyclohexa-1,5-dien-1-ylmethyl)propan-2-amine;ethane (PubChem CID 144703762) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)propan-2-amine;ethane.
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)propan-2-amine;ethane |
|---|---|
| PubChem CID | 144703762 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)propan-2-amine;ethane |
| SMILES | CC.CC(C)NCC1=CCCC=C1 |
| InChI | InChI=1S/C10H17N.C2H6/c1-9(2)11-8-10-6-4-3-5-7-10;1-2/h4,6-7,9,11H,3,5,8H2,1-2H3;1-2H3 |
| InChIKey | DFTNDOSAXMLWLS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |