About 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane
1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane (PubChem CID 143054399) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane |
| PubChem CID | 143054399 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane |
| SMILES | C.CN1CCN(CC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H20N2.CH4/c1-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;/h3,5-6H,2,4,7-11H2,1H3;1H4 |
| InChIKey | ISNWKWXJXUTCAU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane (CID 143054399) is 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane is C.CN1CCN(CC2=CCCC=C2)CC1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane?
The InChIKey is ISNWKWXJXUTCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2.CH4/c1-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;/h3,5-6H,2,4,7-11H2,1H3;1H4.
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane?
1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane has a molecular weight of 208.35 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-methylpiperazine;methane is sourced from PubChem (CID 143054399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).