C13H24N2 — CID 143478856
1-cyclohexa-1,5-dien-1-yl-4-methylpiperazine;ethane (PubChem CID 143478856) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-4-methylpiperazine;ethane.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-4-methylpiperazine;ethane |
|---|---|
| PubChem CID | 143478856 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-4-methylpiperazine;ethane |
| SMILES | CC.CN1CCN(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C11H18N2.C2H6/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11;1-2/h3,5-6H,2,4,7-10H2,1H3;1-2H3 |
| InChIKey | HQWVAIHZJJZYQH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |