C12H20N2O — CID 173071004
2-(4-cyclohexa-1,5-dien-1-ylpiperazin-1-yl)ethanol (PubChem CID 173071004) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,5-dien-1-ylpiperazin-1-yl)ethanol.
| Compound Name | 2-(4-cyclohexa-1,5-dien-1-ylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 173071004 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(4-cyclohexa-1,5-dien-1-ylpiperazin-1-yl)ethanol |
| SMILES | OCCN1CCN(C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C12H20N2O/c15-11-10-13-6-8-14(9-7-13)12-4-2-1-3-5-12/h2,4-5,15H,1,3,6-11H2 |
| InChIKey | KFWPKEMLWSIFKQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |