C12H18N2O4S — CID 22147110
4-[4-(2-hydroxyethyl)piperazin-1-yl]benzenesulfonic acid (PubChem CID 22147110) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[4-(2-hydroxyethyl)piperazin-1-yl]benzenesulfonic acid.
| Compound Name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 22147110 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(N2CCN(CCO)CC2)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c15-10-9-13-5-7-14(8-6-13)11-1-3-12(4-2-11)19(16,17)18/h1-4,15H,5-10H2,(H,16,17,18) |
| InChIKey | TWPGEJDQDCOVJA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|