C14H22N2O4S — CID 91297710
4-[4-(4-hydroxybutyl)piperazin-1-yl]benzenesulfonic acid (PubChem CID 91297710) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[4-(4-hydroxybutyl)piperazin-1-yl]benzenesulfonic acid.
| Compound Name | 4-[4-(4-hydroxybutyl)piperazin-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 91297710 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[4-(4-hydroxybutyl)piperazin-1-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(N2CCN(CCCCO)CC2)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c17-12-2-1-7-15-8-10-16(11-9-15)13-3-5-14(6-4-13)21(18,19)20/h3-6,17H,1-2,7-12H2,(H,18,19,20) |
| InChIKey | GWNUOZPLFVTFBK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|