C14H23N3O4S — CID 175239692
[4-[4-(3-hydroxypropyl)piperazin-1-yl]anilino]methanesulfonic acid (PubChem CID 175239692) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is [4-[4-(3-hydroxypropyl)piperazin-1-yl]anilino]methanesulfonic acid.
| Compound Name | [4-[4-(3-hydroxypropyl)piperazin-1-yl]anilino]methanesulfonic acid |
|---|---|
| PubChem CID | 175239692 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [4-[4-(3-hydroxypropyl)piperazin-1-yl]anilino]methanesulfonic acid |
| SMILES | O=S(=O)(O)CNc1ccc(N2CCN(CCCO)CC2)cc1 |
| InChI | InChI=1S/C14H23N3O4S/c18-11-1-6-16-7-9-17(10-8-16)14-4-2-13(3-5-14)15-12-22(19,20)21/h2-5,15,18H,1,6-12H2,(H,19,20,21) |
| InChIKey | BIJQVCKEEOGPTL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|