C13H22N4O3S — CID 107213964
2-amino-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenesulfonamide (PubChem CID 107213964) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-amino-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenesulfonamide.
| Compound Name | 2-amino-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 107213964 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-amino-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzenesulfonamide |
| SMILES | Nc1cc(N2CCCN(CCO)CC2)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C13H22N4O3S/c14-12-10-11(2-3-13(12)21(15,19)20)17-5-1-4-16(6-7-17)8-9-18/h2-3,10,18H,1,4-9,14H2,(H2,15,19,20) |
| InChIKey | MTMHREYITSGONL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|