C14H18BrN3O — CID 107276841
2-bromo-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzonitrile (PubChem CID 107276841) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-bromo-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzonitrile.
| Compound Name | 2-bromo-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 107276841 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-bromo-4-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCCN(CCO)CC2)cc1Br |
| InChI | InChI=1S/C14H18BrN3O/c15-14-10-13(3-2-12(14)11-16)18-5-1-4-17(6-7-18)8-9-19/h2-3,10,19H,1,4-9H2 |
| InChIKey | QPTRPBGFWIGFDL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |