C11H9BrN2 — CID 130160926
2-bromo-4-(2,5-dihydropyrrol-1-yl)benzonitrile (PubChem CID 130160926) has the molecular formula C11H9BrN2 and a molecular weight of 249.11 g/mol. Its IUPAC name is 2-bromo-4-(2,5-dihydropyrrol-1-yl)benzonitrile.
| Compound Name | 2-bromo-4-(2,5-dihydropyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 130160926 |
| Molecular Formula | C11H9BrN2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-bromo-4-(2,5-dihydropyrrol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CC=CC2)cc1Br |
| InChI | InChI=1S/C11H9BrN2/c12-11-7-10(4-3-9(11)8-13)14-5-1-2-6-14/h1-4,7H,5-6H2 |
| InChIKey | YNYNDSLWQNBYPQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|