C12H13BrN2S — CID 107276033
2-bromo-4-(1,4-thiazepan-4-yl)benzonitrile (PubChem CID 107276033) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 2-bromo-4-(1,4-thiazepan-4-yl)benzonitrile.
| Compound Name | 2-bromo-4-(1,4-thiazepan-4-yl)benzonitrile |
|---|---|
| PubChem CID | 107276033 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-bromo-4-(1,4-thiazepan-4-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCSCC2)cc1Br |
| InChI | InChI=1S/C12H13BrN2S/c13-12-8-11(3-2-10(12)9-14)15-4-1-6-16-7-5-15/h2-3,8H,1,4-7H2 |
| InChIKey | IVVAWYSGZVRICS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |