C12H18N4O3S — CID 79466325
1-(3-amino-4-sulfamoylphenyl)piperidine-4-carboxamide (PubChem CID 79466325) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-(3-amino-4-sulfamoylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-amino-4-sulfamoylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 79466325 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 1-(3-amino-4-sulfamoylphenyl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ccc(S(N)(=O)=O)c(N)c2)CC1 |
| InChI | InChI=1S/C12H18N4O3S/c13-10-7-9(1-2-11(10)20(15,18)19)16-5-3-8(4-6-16)12(14)17/h1-2,7-8H,3-6,13H2,(H2,14,17)(H2,15,18,19) |
| InChIKey | ZMUVPMSDLNYFPX-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|